C14H18F2N2O5S — CID 169081628
tert-butyl 6-(difluoromethylsulfonyloxy)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (PubChem CID 169081628) has the molecular formula C14H18F2N2O5S and a molecular weight of 364.37 g/mol. Its IUPAC name is tert-butyl 6-(difluoromethylsulfonyloxy)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate.
| Compound Name | tert-butyl 6-(difluoromethylsulfonyloxy)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 169081628 |
| Molecular Formula | C14H18F2N2O5S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | tert-butyl 6-(difluoromethylsulfonyloxy)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(OS(=O)(=O)C(F)F)ncc2C1 |
| InChI | InChI=1S/C14H18F2N2O5S/c1-14(2,3)22-13(19)18-5-4-9-6-11(17-7-10(9)8-18)23-24(20,21)12(15)16/h6-7,12H,4-5,8H2,1-3H3 |
| InChIKey | OMSSXQLVPAMIHP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|