C11H14N2O — CID 130658829
(3R)-3-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 130658829) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (3R)-3-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | (3R)-3-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 130658829 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (3R)-3-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | C[C@@H]1Cc2cc(C(N)=O)ccc2CN1 |
| InChI | InChI=1S/C11H14N2O/c1-7-4-10-5-8(11(12)14)2-3-9(10)6-13-7/h2-3,5,7,13H,4,6H2,1H3,(H2,12,14)/t7-/m1/s1 |
| InChIKey | OZBOXTWPCVWLAH-SSDOTTSWSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |