C10H12N2O2 — CID 130040098
2-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxamide (PubChem CID 130040098) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxamide.
| Compound Name | 2-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 130040098 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)NC(CO)C2 |
| InChI | InChI=1S/C10H12N2O2/c11-10(14)7-2-1-6-3-8(5-13)12-9(6)4-7/h1-2,4,8,12-13H,3,5H2,(H2,11,14) |
| InChIKey | VLPMKSACROANPK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |