C15H14N2O — CID 91028665
6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboxamide (PubChem CID 91028665) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboxamide.
| Compound Name | 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboxamide |
|---|---|
| PubChem CID | 91028665 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)Nc1ccccc1CC2 |
| InChI | InChI=1S/C15H14N2O/c16-15(18)12-8-7-11-6-5-10-3-1-2-4-13(10)17-14(11)9-12/h1-4,7-9,17H,5-6H2,(H2,16,18) |
| InChIKey | HQKNSHLBCXYLPN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |