C15H15N3 — CID 86056242
6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboximidamide (PubChem CID 86056242) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboximidamide.
| Compound Name | 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboximidamide |
|---|---|
| PubChem CID | 86056242 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6,11-dihydro-5H-benzo[b][1]benzazepine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)Nc1ccccc1CC2 |
| InChI | InChI=1S/C15H15N3/c16-15(17)12-8-7-11-6-5-10-3-1-2-4-13(10)18-14(11)9-12/h1-4,7-9,18H,5-6H2,(H3,16,17) |
| InChIKey | WNJADOSZFAJIPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|