C15H14FN3 — CID 55050286
4-(1,3-dihydroisoindol-2-yl)-3-fluorobenzenecarboximidamide (PubChem CID 55050286) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)-3-fluorobenzenecarboximidamide.
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 55050286 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C15H14FN3/c16-13-7-10(15(17)18)5-6-14(13)19-8-11-3-1-2-4-12(11)9-19/h1-7H,8-9H2,(H3,17,18) |
| InChIKey | CCRADPOFRNFMFA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|