C10H13N3 — CID 54411310
1,2,3,4-tetrahydroisoquinoline-6-carboximidamide (PubChem CID 54411310) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline-6-carboximidamide.
| Compound Name | 1,2,3,4-tetrahydroisoquinoline-6-carboximidamide |
|---|---|
| PubChem CID | 54411310 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C10H13N3/c11-10(12)8-1-2-9-6-13-4-3-7(9)5-8/h1-2,5,13H,3-4,6H2,(H3,11,12) |
| InChIKey | VUIPUAIVXKGNTD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|