C11H8Br2N2 — CID 121232083
6,7-dibromonaphthalene-2-carboximidamide (PubChem CID 121232083) has the molecular formula C11H8Br2N2 and a molecular weight of 328.01 g/mol. Its IUPAC name is 6,7-dibromonaphthalene-2-carboximidamide.
| Compound Name | 6,7-dibromonaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 121232083 |
| Molecular Formula | C11H8Br2N2 |
| Molecular Weight | 328.01 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 6,7-dibromonaphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(Br)c(Br)cc2c1 |
| InChI | InChI=1S/C11H8Br2N2/c12-9-4-6-1-2-7(11(14)15)3-8(6)5-10(9)13/h1-5H,(H3,14,15) |
| InChIKey | VOOTWZFBDQAPQV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.01 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|