About pyrene-2-carboximidamide
pyrene-2-carboximidamide (PubChem CID 151524830) has the molecular formula C17H12N2
and a molecular weight of 244.30 g/mol. Its IUPAC name is pyrene-2-carboximidamide.
Molecular Properties
| Compound Name | pyrene-2-carboximidamide |
| PubChem CID | 151524830 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | pyrene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C17H12N2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H,(H3,18,19) |
| InChIKey | PVFPUQNXVIUJOC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-2-carboximidamide?
The IUPAC name of pyrene-2-carboximidamide (CID 151524830) is pyrene-2-carboximidamide.
What is the SMILES notation for pyrene-2-carboximidamide?
The canonical SMILES for pyrene-2-carboximidamide is [H]/N=C(\N)c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of pyrene-2-carboximidamide?
The InChIKey is PVFPUQNXVIUJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H,(H3,18,19).
What are the key properties of pyrene-2-carboximidamide?
pyrene-2-carboximidamide has a molecular weight of 244.30 g/mol, XLogP of 3.87, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-2-carboximidamide is sourced from PubChem (CID 151524830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).