C16H20N2O — CID 159127803
5-(2,2-dimethylpropoxy)naphthalene-2-carboximidamide (PubChem CID 159127803) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-(2,2-dimethylpropoxy)naphthalene-2-carboximidamide.
| Compound Name | 5-(2,2-dimethylpropoxy)naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 159127803 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 5-(2,2-dimethylpropoxy)naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(OCC(C)(C)C)cccc2c1 |
| InChI | InChI=1S/C16H20N2O/c1-16(2,3)10-19-14-6-4-5-11-9-12(15(17)18)7-8-13(11)14/h4-9H,10H2,1-3H3,(H3,17,18) |
| InChIKey | KXEURYYUHPOCDA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|