C14H22N2O3 — CID 103033943
3-methoxy-4-(3-methoxy-3-methylbutoxy)benzenecarboximidamide (PubChem CID 103033943) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-methoxy-4-(3-methoxy-3-methylbutoxy)benzenecarboximidamide.
| Compound Name | 3-methoxy-4-(3-methoxy-3-methylbutoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 103033943 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-methoxy-4-(3-methoxy-3-methylbutoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCC(C)(C)OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,18-4)7-8-19-11-6-5-10(13(15)16)9-12(11)17-3/h5-6,9H,7-8H2,1-4H3,(H3,15,16) |
| InChIKey | XKTGDNLUWFACJY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|