C7H9N5 — CID 23373306
pyridine-2,6-dicarboximidamide (PubChem CID 23373306) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is pyridine-2,6-dicarboximidamide.
| Compound Name | pyridine-2,6-dicarboximidamide |
|---|---|
| PubChem CID | 23373306 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | pyridine-2,6-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(/C(N)=N/[H])n1 |
| InChI | InChI=1S/C7H9N5/c8-6(9)4-2-1-3-5(12-4)7(10)11/h1-3H,(H3,8,9)(H3,10,11) |
| InChIKey | ODJWYRZWPHQSDH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|