C12H15N5 — CID 64595960
6-(3,4,5-trimethylpyrazol-1-yl)pyridine-2-carboximidamide (PubChem CID 64595960) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 6-(3,4,5-trimethylpyrazol-1-yl)pyridine-2-carboximidamide.
| Compound Name | 6-(3,4,5-trimethylpyrazol-1-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 64595960 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-(3,4,5-trimethylpyrazol-1-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-n2nc(C)c(C)c2C)n1 |
| InChI | InChI=1S/C12H15N5/c1-7-8(2)16-17(9(7)3)11-6-4-5-10(15-11)12(13)14/h4-6H,1-3H3,(H3,13,14) |
| InChIKey | WSGQKXAFWAAYST-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|