C13H20N4S — CID 107455450
6-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridine-2-carboximidamide (PubChem CID 107455450) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 6-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridine-2-carboximidamide.
| Compound Name | 6-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 107455450 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 6-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CCSC(C)(C)CC2)n1 |
| InChI | InChI=1S/C13H20N4S/c1-13(2)6-7-17(8-9-18-13)11-5-3-4-10(16-11)12(14)15/h3-5H,6-9H2,1-2H3,(H3,14,15) |
| InChIKey | FBSGDQJPHFRQRA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|