C14H20BrN3S — CID 107455465
4-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarboximidamide (PubChem CID 107455465) has the molecular formula C14H20BrN3S and a molecular weight of 342.31 g/mol. Its IUPAC name is 4-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarboximidamide.
| Compound Name | 4-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107455465 |
| Molecular Formula | C14H20BrN3S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Br)cc1N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C14H20BrN3S/c1-14(2)5-6-18(7-8-19-14)12-9-10(15)3-4-11(12)13(16)17/h3-4,9H,5-8H2,1-2H3,(H3,16,17) |
| InChIKey | JCDYENIOSPTPDK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|