C14H20BrN3OS — CID 107455345
5-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxybenzenecarboximidamide (PubChem CID 107455345) has the molecular formula C14H20BrN3OS and a molecular weight of 358.31 g/mol. Its IUPAC name is 5-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 5-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107455345 |
| Molecular Formula | C14H20BrN3OS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-bromo-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1(C)CCN(c2ccc(Br)cc2/C(N)=N/O)CCS1 |
| InChI | InChI=1S/C14H20BrN3OS/c1-14(2)5-6-18(7-8-20-14)12-4-3-10(15)9-11(12)13(16)17-19/h3-4,9,19H,5-8H2,1-2H3,(H2,16,17) |
| InChIKey | QGMPLVULKAHRHW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|