C13H19ClN4OS — CID 136905770
3-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136905770) has the molecular formula C13H19ClN4OS and a molecular weight of 314.84 g/mol. Its IUPAC name is 3-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136905770 |
| Molecular Formula | C13H19ClN4OS |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N'-hydroxypyridine-4-carboximidamide |
| SMILES | CC1(C)CCN(c2nccc(/C(N)=N/O)c2Cl)CCS1 |
| InChI | InChI=1S/C13H19ClN4OS/c1-13(2)4-6-18(7-8-20-13)12-10(14)9(3-5-16-12)11(15)17-19/h3,5,19H,4,6-8H2,1-2H3,(H2,15,17) |
| InChIKey | CQAZWGNETCGJQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|