C11H17N5OS — CID 136906933
2-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxypyrimidine-4-carboximidamide (PubChem CID 136906933) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 2-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxypyrimidine-4-carboximidamide.
| Compound Name | 2-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxypyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906933 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxypyrimidine-4-carboximidamide |
| SMILES | CC1(C)CN(c2nccc(/C(N)=N/O)n2)CCS1 |
| InChI | InChI=1S/C11H17N5OS/c1-11(2)7-16(5-6-18-11)10-13-4-3-8(14-10)9(12)15-17/h3-4,17H,5-7H2,1-2H3,(H2,12,15) |
| InChIKey | OYTINPGMUZFEEF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|