C10H16N6O3S — CID 136906717
N'-hydroxy-2-(4-methylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidamide (PubChem CID 136906717) has the molecular formula C10H16N6O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N'-hydroxy-2-(4-methylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-(4-methylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906717 |
| Molecular Formula | C10H16N6O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N'-hydroxy-2-(4-methylsulfonylpiperazin-1-yl)pyrimidine-4-carboximidamide |
| SMILES | CS(=O)(=O)N1CCN(c2nccc(/C(N)=N/O)n2)CC1 |
| InChI | InChI=1S/C10H16N6O3S/c1-20(18,19)16-6-4-15(5-7-16)10-12-3-2-8(13-10)9(11)14-17/h2-3,17H,4-7H2,1H3,(H2,11,14) |
| InChIKey | SUHNQJMOAGQNDH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|