C14H23N5O — CID 136906728
2-(4,4-diethylpiperidin-1-yl)-N'-hydroxypyrimidine-4-carboximidamide (PubChem CID 136906728) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(4,4-diethylpiperidin-1-yl)-N'-hydroxypyrimidine-4-carboximidamide.
| Compound Name | 2-(4,4-diethylpiperidin-1-yl)-N'-hydroxypyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906728 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-(4,4-diethylpiperidin-1-yl)-N'-hydroxypyrimidine-4-carboximidamide |
| SMILES | CCC1(CC)CCN(c2nccc(/C(N)=N/O)n2)CC1 |
| InChI | InChI=1S/C14H23N5O/c1-3-14(4-2)6-9-19(10-7-14)13-16-8-5-11(17-13)12(15)18-20/h5,8,20H,3-4,6-7,9-10H2,1-2H3,(H2,15,18) |
| InChIKey | VGWOAAUTJWJJPU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|