C13H18BrN3OS — CID 114883354
2-bromo-6-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxybenzenecarboximidamide (PubChem CID 114883354) has the molecular formula C13H18BrN3OS and a molecular weight of 344.28 g/mol. Its IUPAC name is 2-bromo-6-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-bromo-6-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114883354 |
| Molecular Formula | C13H18BrN3OS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-bromo-6-(2,2-dimethylthiomorpholin-4-yl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1(C)CN(c2cccc(Br)c2/C(N)=N/O)CCS1 |
| InChI | InChI=1S/C13H18BrN3OS/c1-13(2)8-17(6-7-19-13)10-5-3-4-9(14)11(10)12(15)16-18/h3-5,18H,6-8H2,1-2H3,(H2,15,16) |
| InChIKey | FVRYUQXVWQNGDF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|