C12H18N4S2 — CID 107455172
3-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridazine-4-carbothioamide (PubChem CID 107455172) has the molecular formula C12H18N4S2 and a molecular weight of 282.44 g/mol. Its IUPAC name is 3-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridazine-4-carbothioamide.
| Compound Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 107455172 |
| Molecular Formula | C12H18N4S2 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)pyridazine-4-carbothioamide |
| SMILES | CC1(C)CCN(c2nnccc2C(N)=S)CCS1 |
| InChI | InChI=1S/C12H18N4S2/c1-12(2)4-6-16(7-8-18-12)11-9(10(13)17)3-5-14-15-11/h3,5H,4,6-8H2,1-2H3,(H2,13,17) |
| InChIKey | IJXNPXPUBFQXFW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|