C13H20N4S — CID 80511713
3-(4,4-dimethylazepan-1-yl)pyridazine-4-carbothioamide (PubChem CID 80511713) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)pyridazine-4-carbothioamide.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511713 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)pyridazine-4-carbothioamide |
| SMILES | CC1(C)CCCN(c2nnccc2C(N)=S)CC1 |
| InChI | InChI=1S/C13H20N4S/c1-13(2)5-3-8-17(9-6-13)12-10(11(14)18)4-7-15-16-12/h4,7H,3,5-6,8-9H2,1-2H3,(H2,14,18) |
| InChIKey | AHDSJRHJXHMSBU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|