C11H14N4O3S — CID 115534896
methyl 4-(4-carbamothioylpyridazin-3-yl)morpholine-2-carboxylate (PubChem CID 115534896) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 4-(4-carbamothioylpyridazin-3-yl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(4-carbamothioylpyridazin-3-yl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 115534896 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 4-(4-carbamothioylpyridazin-3-yl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(c2nnccc2C(N)=S)CCO1 |
| InChI | InChI=1S/C11H14N4O3S/c1-17-11(16)8-6-15(4-5-18-8)10-7(9(12)19)2-3-13-14-10/h2-3,8H,4-6H2,1H3,(H2,12,19) |
| InChIKey | VSRGQOXBNDZWAJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|