C13H17N3O4 — CID 79770247
methyl 2-[4-(3-carbamoyl-2-pyridinyl)morpholin-2-yl]acetate (PubChem CID 79770247) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 2-[4-(3-carbamoyl-2-pyridinyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(3-carbamoyl-2-pyridinyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79770247 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 2-[4-(3-carbamoyl-2-pyridinyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(c2ncccc2C(N)=O)CCO1 |
| InChI | InChI=1S/C13H17N3O4/c1-19-11(17)7-9-8-16(5-6-20-9)13-10(12(14)18)3-2-4-15-13/h2-4,9H,5-8H2,1H3,(H2,14,18) |
| InChIKey | VBVDOTIJHCSISG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |