C13H15ClN2O3S — CID 115534893
methyl 4-(4-carbamothioyl-2-chlorophenyl)morpholine-2-carboxylate (PubChem CID 115534893) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is methyl 4-(4-carbamothioyl-2-chlorophenyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(4-carbamothioyl-2-chlorophenyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 115534893 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | methyl 4-(4-carbamothioyl-2-chlorophenyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(c2ccc(C(N)=S)cc2Cl)CCO1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-18-13(17)11-7-16(4-5-19-11)10-3-2-8(12(15)20)6-9(10)14/h2-3,6,11H,4-5,7H2,1H3,(H2,15,20) |
| InChIKey | PTGOIMAZUDNNII-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|