C13H16F2N2S2 — CID 107935283
4-(2,2-dimethylthiomorpholin-4-yl)-2,3-difluorobenzenecarbothioamide (PubChem CID 107935283) has the molecular formula C13H16F2N2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-(2,2-dimethylthiomorpholin-4-yl)-2,3-difluorobenzenecarbothioamide.
| Compound Name | 4-(2,2-dimethylthiomorpholin-4-yl)-2,3-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107935283 |
| Molecular Formula | C13H16F2N2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(2,2-dimethylthiomorpholin-4-yl)-2,3-difluorobenzenecarbothioamide |
| SMILES | CC1(C)CN(c2ccc(C(N)=S)c(F)c2F)CCS1 |
| InChI | InChI=1S/C13H16F2N2S2/c1-13(2)7-17(5-6-19-13)9-4-3-8(12(16)18)10(14)11(9)15/h3-4H,5-7H2,1-2H3,(H2,16,18) |
| InChIKey | MPHDBIQUNVRTAK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|