C14H19ClN2S2 — CID 107455133
5-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarbothioamide (PubChem CID 107455133) has the molecular formula C14H19ClN2S2 and a molecular weight of 314.91 g/mol. Its IUPAC name is 5-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107455133 |
| Molecular Formula | C14H19ClN2S2 |
| Molecular Weight | 314.91 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-chloro-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzenecarbothioamide |
| SMILES | CC1(C)CCN(c2ccc(Cl)cc2C(N)=S)CCS1 |
| InChI | InChI=1S/C14H19ClN2S2/c1-14(2)5-6-17(7-8-19-14)12-4-3-10(15)9-11(12)13(16)18/h3-4,9H,5-8H2,1-2H3,(H2,16,18) |
| InChIKey | IJEGJUMMNVXWQE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|