About 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide
2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide (PubChem CID 107535507) has the molecular formula C14H18BrFN2S2
and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide.
Molecular Properties
| Compound Name | 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide |
| PubChem CID | 107535507 |
| Molecular Formula | C14H18BrFN2S2 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide |
| SMILES | CC1(C)CCN(c2ccc(C(N)=S)c(Br)c2F)CCS1 |
| InChI | InChI=1S/C14H18BrFN2S2/c1-14(2)5-6-18(7-8-20-14)10-4-3-9(13(17)19)11(15)12(10)16/h3-4H,5-8H2,1-2H3,(H2,17,19) |
| InChIKey | HSZIFGCYVAYUFN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide?
The IUPAC name of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide (CID 107535507) is 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide.
What is the SMILES notation for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide?
The canonical SMILES for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide is CC1(C)CCN(c2ccc(C(N)=S)c(Br)c2F)CCS1.
What is the InChIKey of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide?
The InChIKey is HSZIFGCYVAYUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrFN2S2/c1-14(2)5-6-18(7-8-20-14)10-4-3-9(13(17)19)11(15)12(10)16/h3-4H,5-8H2,1-2H3,(H2,17,19).
What are the key properties of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide?
2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide has a molecular weight of 377.35 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorobenzenecarbothioamide is sourced from PubChem (CID 107535507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).