C14H17BrFN3OS — CID 107535265
2-bromo-3-fluoro-4-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide (PubChem CID 107535265) has the molecular formula C14H17BrFN3OS and a molecular weight of 374.28 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107535265 |
| Molecular Formula | C14H17BrFN3OS |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-bromo-3-fluoro-4-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzenecarbothioamide |
| SMILES | CN1CCN(c2ccc(C(N)=S)c(Br)c2F)C(C)(C)C1=O |
| InChI | InChI=1S/C14H17BrFN3OS/c1-14(2)13(20)18(3)6-7-19(14)9-5-4-8(12(17)21)10(15)11(9)16/h4-5H,6-7H2,1-3H3,(H2,17,21) |
| InChIKey | WUBCHUWOIVBAFQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|