C13H16BrFN2O2S — CID 107535486
2-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide (PubChem CID 107535486) has the molecular formula C13H16BrFN2O2S and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535486 |
| Molecular Formula | C13H16BrFN2O2S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide |
| SMILES | COC1CN(c2ccc(C(N)=S)c(Br)c2F)CC1OC |
| InChI | InChI=1S/C13H16BrFN2O2S/c1-18-9-5-17(6-10(9)19-2)8-4-3-7(13(16)20)11(14)12(8)15/h3-4,9-10H,5-6H2,1-2H3,(H2,16,20) |
| InChIKey | MXFFULPVDPOINB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|