C14H16BrFN2OS — CID 107535349
2-bromo-3-fluoro-4-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)benzenecarbothioamide (PubChem CID 107535349) has the molecular formula C14H16BrFN2OS and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107535349 |
| Molecular Formula | C14H16BrFN2OS |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-bromo-3-fluoro-4-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CC3CCC(O)C3C2)c(F)c1Br |
| InChI | InChI=1S/C14H16BrFN2OS/c15-12-8(14(17)20)2-3-10(13(12)16)18-5-7-1-4-11(19)9(7)6-18/h2-3,7,9,11,19H,1,4-6H2,(H2,17,20) |
| InChIKey | YXQPPQKYPBVXSG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|