C13H16BrFN2S2 — CID 107535152
2-bromo-4-(2,6-dimethylthiomorpholin-4-yl)-3-fluorobenzenecarbothioamide (PubChem CID 107535152) has the molecular formula C13H16BrFN2S2 and a molecular weight of 363.32 g/mol. Its IUPAC name is 2-bromo-4-(2,6-dimethylthiomorpholin-4-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,6-dimethylthiomorpholin-4-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535152 |
| Molecular Formula | C13H16BrFN2S2 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-bromo-4-(2,6-dimethylthiomorpholin-4-yl)-3-fluorobenzenecarbothioamide |
| SMILES | CC1CN(c2ccc(C(N)=S)c(Br)c2F)CC(C)S1 |
| InChI | InChI=1S/C13H16BrFN2S2/c1-7-5-17(6-8(2)19-7)10-4-3-9(13(16)18)11(14)12(10)15/h3-4,7-8H,5-6H2,1-2H3,(H2,16,18) |
| InChIKey | HTLFRQVHOPANPM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|