C14H17BrFN3OS — CID 107535479
1-(3-bromo-4-carbamothioyl-2-fluorophenyl)-N-methylpiperidine-3-carboxamide (PubChem CID 107535479) has the molecular formula C14H17BrFN3OS and a molecular weight of 374.28 g/mol. Its IUPAC name is 1-(3-bromo-4-carbamothioyl-2-fluorophenyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(3-bromo-4-carbamothioyl-2-fluorophenyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 107535479 |
| Molecular Formula | C14H17BrFN3OS |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-(3-bromo-4-carbamothioyl-2-fluorophenyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(c2ccc(C(N)=S)c(Br)c2F)C1 |
| InChI | InChI=1S/C14H17BrFN3OS/c1-18-14(20)8-3-2-6-19(7-8)10-5-4-9(13(17)21)11(15)12(10)16/h4-5,8H,2-3,6-7H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | MUVYYMRPCUEWJH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|