C11H12BrFN2O2S — CID 107535489
2-bromo-4-(3,4-dihydroxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide (PubChem CID 107535489) has the molecular formula C11H12BrFN2O2S and a molecular weight of 335.20 g/mol. Its IUPAC name is 2-bromo-4-(3,4-dihydroxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-(3,4-dihydroxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535489 |
| Molecular Formula | C11H12BrFN2O2S |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2-bromo-4-(3,4-dihydroxypyrrolidin-1-yl)-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CC(O)C(O)C2)c(F)c1Br |
| InChI | InChI=1S/C11H12BrFN2O2S/c12-9-5(11(14)18)1-2-6(10(9)13)15-3-7(16)8(17)4-15/h1-2,7-8,16-17H,3-4H2,(H2,14,18) |
| InChIKey | PZTBNEZEDYMVFE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|