C16H20BrFN2S — CID 107534726
4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-bromo-3-fluorobenzenecarbothioamide (PubChem CID 107534726) has the molecular formula C16H20BrFN2S and a molecular weight of 371.32 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-bromo-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-bromo-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107534726 |
| Molecular Formula | C16H20BrFN2S |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-bromo-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCC3CCCCC3C2)c(F)c1Br |
| InChI | InChI=1S/C16H20BrFN2S/c17-14-12(16(19)21)5-6-13(15(14)18)20-8-7-10-3-1-2-4-11(10)9-20/h5-6,10-11H,1-4,7-9H2,(H2,19,21) |
| InChIKey | VUIJQIGXMZTUGD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|