C13H17BrFN3O — CID 116736119
4-(2-amino-5-bromo-4-fluorophenyl)-1,3,3-trimethylpiperazin-2-one (PubChem CID 116736119) has the molecular formula C13H17BrFN3O and a molecular weight of 330.20 g/mol. Its IUPAC name is 4-(2-amino-5-bromo-4-fluorophenyl)-1,3,3-trimethylpiperazin-2-one.
| Compound Name | 4-(2-amino-5-bromo-4-fluorophenyl)-1,3,3-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 116736119 |
| Molecular Formula | C13H17BrFN3O |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-(2-amino-5-bromo-4-fluorophenyl)-1,3,3-trimethylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(Br)c(F)cc2N)C(C)(C)C1=O |
| InChI | InChI=1S/C13H17BrFN3O/c1-13(2)12(19)17(3)4-5-18(13)11-6-8(14)9(15)7-10(11)16/h6-7H,4-5,16H2,1-3H3 |
| InChIKey | MEEXHQXJDZQRTB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|