C14H18ClN3O3 — CID 107196321
5-amino-3-chloro-2-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzoic acid (PubChem CID 107196321) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 107196321 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2,4-trimethyl-3-oxopiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2c(Cl)cc(N)cc2C(=O)O)C(C)(C)C1=O |
| InChI | InChI=1S/C14H18ClN3O3/c1-14(2)13(21)17(3)4-5-18(14)11-9(12(19)20)6-8(16)7-10(11)15/h6-7H,4-5,16H2,1-3H3,(H,19,20) |
| InChIKey | ZQEABKDGSPLZLU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|