C13H17ClN2O3 — CID 107195739
5-amino-3-chloro-2-(2-methyl-1,4-oxazepan-4-yl)benzoic acid (PubChem CID 107195739) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2-methyl-1,4-oxazepan-4-yl)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(2-methyl-1,4-oxazepan-4-yl)benzoic acid |
|---|---|
| PubChem CID | 107195739 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-amino-3-chloro-2-(2-methyl-1,4-oxazepan-4-yl)benzoic acid |
| SMILES | CC1CN(c2c(Cl)cc(N)cc2C(=O)O)CCCO1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-8-7-16(3-2-4-19-8)12-10(13(17)18)5-9(15)6-11(12)14/h5-6,8H,2-4,7,15H2,1H3,(H,17,18) |
| InChIKey | LIUISMGGGPESQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|