C15H21ClN2O3 — CID 107195539
methyl 5-amino-3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzoate (PubChem CID 107195539) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzoate |
|---|---|
| PubChem CID | 107195539 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 5-amino-3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1N1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-9-7-18(8-15(2,3)21-9)13-11(14(19)20-4)5-10(17)6-12(13)16/h5-6,9H,7-8,17H2,1-4H3 |
| InChIKey | HLTJYWCKHGPGIH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|