C13H18ClN3O2 — CID 107194238
5-amino-3-chloro-2-(2,2-dimethylmorpholin-4-yl)benzamide (PubChem CID 107194238) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2-dimethylmorpholin-4-yl)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,2-dimethylmorpholin-4-yl)benzamide |
|---|---|
| PubChem CID | 107194238 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2-dimethylmorpholin-4-yl)benzamide |
| SMILES | CC1(C)CN(c2c(Cl)cc(N)cc2C(N)=O)CCO1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-13(2)7-17(3-4-19-13)11-9(12(16)18)5-8(15)6-10(11)14/h5-6H,3-4,7,15H2,1-2H3,(H2,16,18) |
| InChIKey | NMOARBIAWWTBED-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|