C15H22ClN3O — CID 107195785
5-amino-3-chloro-2-(4-ethyl-4-methylpiperidin-1-yl)benzamide (PubChem CID 107195785) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(4-ethyl-4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-amino-3-chloro-2-(4-ethyl-4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 107195785 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 5-amino-3-chloro-2-(4-ethyl-4-methylpiperidin-1-yl)benzamide |
| SMILES | CCC1(C)CCN(c2c(Cl)cc(N)cc2C(N)=O)CC1 |
| InChI | InChI=1S/C15H22ClN3O/c1-3-15(2)4-6-19(7-5-15)13-11(14(18)20)8-10(17)9-12(13)16/h8-9H,3-7,17H2,1-2H3,(H2,18,20) |
| InChIKey | DXIQAOKSWRKLKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|