C15H22ClN3O2 — CID 107195880
methyl 5-amino-3-chloro-2-(3,3,4-trimethylpiperazin-1-yl)benzoate (PubChem CID 107195880) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-(3,3,4-trimethylpiperazin-1-yl)benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-(3,3,4-trimethylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 107195880 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl 5-amino-3-chloro-2-(3,3,4-trimethylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-15(2)9-19(6-5-18(15)3)13-11(14(20)21-4)7-10(17)8-12(13)16/h7-8H,5-6,9,17H2,1-4H3 |
| InChIKey | SXTOWANGWPSVCQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|