C14H19ClN2O3 — CID 107196893
methyl 5-amino-3-chloro-2-(4-hydroxy-3-methylpiperidin-1-yl)benzoate (PubChem CID 107196893) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-(4-hydroxy-3-methylpiperidin-1-yl)benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-(4-hydroxy-3-methylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 107196893 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 5-amino-3-chloro-2-(4-hydroxy-3-methylpiperidin-1-yl)benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1N1CCC(O)C(C)C1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-8-7-17(4-3-12(8)18)13-10(14(19)20-2)5-9(16)6-11(13)15/h5-6,8,12,18H,3-4,7,16H2,1-2H3 |
| InChIKey | YFIQNJZTADMPMV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|