C15H23ClN4O — CID 107195794
5-amino-3-chloro-2-[3-(diethylamino)pyrrolidin-1-yl]benzamide (PubChem CID 107195794) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[3-(diethylamino)pyrrolidin-1-yl]benzamide.
| Compound Name | 5-amino-3-chloro-2-[3-(diethylamino)pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 107195794 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 5-amino-3-chloro-2-[3-(diethylamino)pyrrolidin-1-yl]benzamide |
| SMILES | CCN(CC)C1CCN(c2c(Cl)cc(N)cc2C(N)=O)C1 |
| InChI | InChI=1S/C15H23ClN4O/c1-3-19(4-2)11-5-6-20(9-11)14-12(15(18)21)7-10(17)8-13(14)16/h7-8,11H,3-6,9,17H2,1-2H3,(H2,18,21) |
| InChIKey | XUAODHARPCCRAS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|