C15H22ClN3O2 — CID 120635811
4-(5-amino-2-methylbenzoyl)-1,3,3-trimethylpiperazin-2-one;hydrochloride (PubChem CID 120635811) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 4-(5-amino-2-methylbenzoyl)-1,3,3-trimethylpiperazin-2-one;hydrochloride.
| Compound Name | 4-(5-amino-2-methylbenzoyl)-1,3,3-trimethylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120635811 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-(5-amino-2-methylbenzoyl)-1,3,3-trimethylpiperazin-2-one;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(C)C(=O)C1(C)C.Cl |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-10-5-6-11(16)9-12(10)13(19)18-8-7-17(4)14(20)15(18,2)3;/h5-6,9H,7-8,16H2,1-4H3;1H |
| InChIKey | CMGHORBFUMDBMC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|