C14H17Cl2N3O2 — CID 107185544
4-(5-amino-2,3-dichlorobenzoyl)-1,3,3-trimethylpiperazin-2-one (PubChem CID 107185544) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 4-(5-amino-2,3-dichlorobenzoyl)-1,3,3-trimethylpiperazin-2-one.
| Compound Name | 4-(5-amino-2,3-dichlorobenzoyl)-1,3,3-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 107185544 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(5-amino-2,3-dichlorobenzoyl)-1,3,3-trimethylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)c2cc(N)cc(Cl)c2Cl)C(C)(C)C1=O |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-14(2)13(21)18(3)4-5-19(14)12(20)9-6-8(17)7-10(15)11(9)16/h6-7H,4-5,17H2,1-3H3 |
| InChIKey | LNDGBDWXMBLZCC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|