C13H19ClN2O3S — CID 120632356
(5-amino-2-methylphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone;hydrochloride (PubChem CID 120632356) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone;hydrochloride.
| Compound Name | (5-amino-2-methylphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120632356 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (5-amino-2-methylphenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCCS(=O)(=O)CC1.Cl |
| InChI | InChI=1S/C13H18N2O3S.ClH/c1-10-3-4-11(14)9-12(10)13(16)15-5-2-7-19(17,18)8-6-15;/h3-4,9H,2,5-8,14H2,1H3;1H |
| InChIKey | VBAOWAIPYLVDEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|