C11H13ClN2O3S — CID 43581076
(5-amino-2-chlorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 43581076) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is (5-amino-2-chlorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (5-amino-2-chlorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 43581076 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | (5-amino-2-chlorophenyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | Nc1ccc(Cl)c(C(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H13ClN2O3S/c12-10-2-1-8(13)7-9(10)11(15)14-3-5-18(16,17)6-4-14/h1-2,7H,3-6,13H2 |
| InChIKey | YZVUKUJTXVBJLB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|