C11H13F2N3O — CID 112751827
4-(2-amino-4,5-difluorophenyl)-1-methylpiperazin-2-one (PubChem CID 112751827) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is 4-(2-amino-4,5-difluorophenyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2-amino-4,5-difluorophenyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 112751827 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-(2-amino-4,5-difluorophenyl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(F)c(F)cc2N)CC1=O |
| InChI | InChI=1S/C11H13F2N3O/c1-15-2-3-16(6-11(15)17)10-5-8(13)7(12)4-9(10)14/h4-5H,2-3,6,14H2,1H3 |
| InChIKey | REWMNRVJJILAGW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|